C16H24N2O4 — CID 124845826
methyl 5-[(1S)-1-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]ethyl]-3-methylfuran-2-carboxylate (PubChem CID 124845826) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 5-[(1S)-1-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]ethyl]-3-methylfuran-2-carboxylate.
| Compound Name | methyl 5-[(1S)-1-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]ethyl]-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 124845826 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methyl 5-[(1S)-1-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]ethyl]-3-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1oc([C@H](C)N2C[C@@H]3OCCN(C)[C@H]3C2)cc1C |
| InChI | InChI=1S/C16H24N2O4/c1-10-7-13(22-15(10)16(19)20-4)11(2)18-8-12-14(9-18)21-6-5-17(12)3/h7,11-12,14H,5-6,8-9H2,1-4H3/t11-,12-,14-/m0/s1 |
| InChIKey | VKWUHDPWPPZFCP-OBJOEFQTSA-N |
| XLogP | 1.45 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |