C16H22N6O — CID 98851778
(4aS,7aS)-4-methyl-6-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 98851778) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is (4aS,7aS)-4-methyl-6-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-4-methyl-6-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 98851778 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4aS,7aS)-4-methyl-6-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | C[C@H](c1nnnn1-c1ccccc1)N1C[C@@H]2OCCN(C)[C@H]2C1 |
| InChI | InChI=1S/C16H22N6O/c1-12(21-10-14-15(11-21)23-9-8-20(14)2)16-17-18-19-22(16)13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3/t12-,14+,15+/m1/s1 |
| InChIKey | GKKXFAURACPONY-SNPRPXQTSA-N |
| XLogP | 0.74 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |