C20H27N3O3 — CID 124849461
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-[4-(1-methylpyrazol-4-yl)phenoxy]butan-1-one (PubChem CID 124849461) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-[4-(1-methylpyrazol-4-yl)phenoxy]butan-1-one.
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-[4-(1-methylpyrazol-4-yl)phenoxy]butan-1-one |
|---|---|
| PubChem CID | 124849461 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-[4-(1-methylpyrazol-4-yl)phenoxy]butan-1-one |
| SMILES | C[C@@H]1CN(C(=O)CCCOc2ccc(-c3cnn(C)c3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H27N3O3/c1-15-12-23(13-16(2)26-15)20(24)5-4-10-25-19-8-6-17(7-9-19)18-11-21-22(3)14-18/h6-9,11,14-16H,4-5,10,12-13H2,1-3H3/t15-,16+ |
| InChIKey | ORWZLSPWJHGUQM-IYBDPMFKSA-N |
| XLogP | 2.88 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|