C17H17FN2O3 — CID 124850619
2-[(2-fluorophenyl)methoxy]-N-[(3R)-oxolan-3-yl]pyridine-3-carboxamide (PubChem CID 124850619) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methoxy]-N-[(3R)-oxolan-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(2-fluorophenyl)methoxy]-N-[(3R)-oxolan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124850619 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[(2-fluorophenyl)methoxy]-N-[(3R)-oxolan-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC1)c1cccnc1OCc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O3/c18-15-6-2-1-4-12(15)10-23-17-14(5-3-8-19-17)16(21)20-13-7-9-22-11-13/h1-6,8,13H,7,9-11H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | QUVMWPMSJBEERX-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |