C14H10F3N5O2S — CID 124850862
5-thiophen-2-yl-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-1,2-oxazole-3-carboxamide (PubChem CID 124850862) has the molecular formula C14H10F3N5O2S and a molecular weight of 369.33 g/mol. Its IUPAC name is 5-thiophen-2-yl-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-thiophen-2-yl-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 124850862 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-thiophen-2-yl-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccn(CC(F)(F)F)n1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C14H10F3N5O2S/c15-14(16,17)8-22-4-3-9(20-22)7-18-19-13(23)10-6-11(24-21-10)12-2-1-5-25-12/h1-7H,8H2,(H,19,23)/b18-7- |
| InChIKey | RFFNZFXSGDKQSQ-WSVATBPTSA-N |
| XLogP | 2.93 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|