C14H24N4O2 — CID 124852947
(2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propanamide (PubChem CID 124852947) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propanamide.
| Compound Name | (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 124852947 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]propanamide |
| SMILES | C[C@H](Cn1cccn1)N[C@@H](C)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H24N4O2/c1-11(10-18-7-4-6-16-18)17-12(2)14(19)15-9-13-5-3-8-20-13/h4,6-7,11-13,17H,3,5,8-10H2,1-2H3,(H,15,19)/t11-,12+,13-/m1/s1 |
| InChIKey | DGOIHVVPGDBIPA-FRRDWIJNSA-N |
| XLogP | 0.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |