C15H26N4OS — CID 51389754
1-[(2S)-3,3-dimethyl-1-pyrazol-1-ylbutan-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 51389754) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-[(2S)-3,3-dimethyl-1-pyrazol-1-ylbutan-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(2S)-3,3-dimethyl-1-pyrazol-1-ylbutan-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 51389754 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[(2S)-3,3-dimethyl-1-pyrazol-1-ylbutan-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | CC(C)(C)[C@@H](Cn1cccn1)NC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H26N4OS/c1-15(2,3)13(11-19-8-5-7-17-19)18-14(21)16-10-12-6-4-9-20-12/h5,7-8,12-13H,4,6,9-11H2,1-3H3,(H2,16,18,21)/t12-,13+/m0/s1 |
| InChIKey | BQZPLNDTWPEGJJ-QWHCGFSZSA-N |
| XLogP | 1.94 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|