C15H20N2O4S — CID 124854790
(2S)-7-(azepan-1-ylsulfonyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 124854790) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is (2S)-7-(azepan-1-ylsulfonyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-7-(azepan-1-ylsulfonyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 124854790 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2S)-7-(azepan-1-ylsulfonyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2cc(S(=O)(=O)N3CCCCCC3)ccc2NC1=O |
| InChI | InChI=1S/C15H20N2O4S/c1-11-15(18)16-13-7-6-12(10-14(13)21-11)22(19,20)17-8-4-2-3-5-9-17/h6-7,10-11H,2-5,8-9H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | XWCBTAYSDLXSIP-NSHDSACASA-N |
| XLogP | 1.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |