C11H21NO2S — CID 124855975
(2S)-N-[(1S,2R)-2-hydroxycyclohexyl]-2-methylsulfanylbutanamide (PubChem CID 124855975) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is (2S)-N-[(1S,2R)-2-hydroxycyclohexyl]-2-methylsulfanylbutanamide.
| Compound Name | (2S)-N-[(1S,2R)-2-hydroxycyclohexyl]-2-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 124855975 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2S)-N-[(1S,2R)-2-hydroxycyclohexyl]-2-methylsulfanylbutanamide |
| SMILES | CC[C@H](SC)C(=O)N[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H21NO2S/c1-3-10(15-2)11(14)12-8-6-4-5-7-9(8)13/h8-10,13H,3-7H2,1-2H3,(H,12,14)/t8-,9+,10-/m0/s1 |
| InChIKey | DDUGSMSRKOFSLZ-AEJSXWLSSA-N |
| XLogP | 1.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |