C10H19NO3 — CID 70915127
N-(2-hydroxycyclopentyl)-2-(hydroxymethyl)butanamide (PubChem CID 70915127) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(2-hydroxycyclopentyl)-2-(hydroxymethyl)butanamide.
| Compound Name | N-(2-hydroxycyclopentyl)-2-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 70915127 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-(2-hydroxycyclopentyl)-2-(hydroxymethyl)butanamide |
| SMILES | CCC(CO)C(=O)NC1CCCC1O |
| InChI | InChI=1S/C10H19NO3/c1-2-7(6-12)10(14)11-8-4-3-5-9(8)13/h7-9,12-13H,2-6H2,1H3,(H,11,14) |
| InChIKey | PDAWIXGSSPTOED-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |