C18H28N2O3 — CID 124857372
2-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl (3S)-1-carbamoylpiperidine-3-carboxylate (PubChem CID 124857372) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl (3S)-1-carbamoylpiperidine-3-carboxylate.
| Compound Name | 2-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl (3S)-1-carbamoylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 124857372 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl (3S)-1-carbamoylpiperidine-3-carboxylate |
| SMILES | CC1(C)[C@H]2CC=C(CCOC(=O)[C@H]3CCCN(C(N)=O)C3)[C@H]1C2 |
| InChI | InChI=1S/C18H28N2O3/c1-18(2)14-6-5-12(15(18)10-14)7-9-23-16(21)13-4-3-8-20(11-13)17(19)22/h5,13-15H,3-4,6-11H2,1-2H3,(H2,19,22)/t13-,14-,15+/m0/s1 |
| InChIKey | CGDUYPOXNSGCRK-SOUVJXGZSA-N |
| XLogP | 2.70 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|