C19H22ClNO3 — CID 2391138
2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl N-(4-chlorobenzoyl)carbamate (PubChem CID 2391138) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl N-(4-chlorobenzoyl)carbamate.
| Compound Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl N-(4-chlorobenzoyl)carbamate |
|---|---|
| PubChem CID | 2391138 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl N-(4-chlorobenzoyl)carbamate |
| SMILES | CC1(C)[C@H]2CC=C(CCOC(=O)NC(=O)c3ccc(Cl)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C19H22ClNO3/c1-19(2)14-6-3-12(16(19)11-14)9-10-24-18(23)21-17(22)13-4-7-15(20)8-5-13/h3-5,7-8,14,16H,6,9-11H2,1-2H3,(H,21,22,23)/t14-,16-/m0/s1 |
| InChIKey | NMCIEMULWTVBDM-HOCLYGCPSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|