C15H21N3O — CID 118776187
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1H-imidazole-5-carboxamide (PubChem CID 118776187) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 118776187 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1H-imidazole-5-carboxamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNC(=O)c3cnc[nH]3)[C@@H]1C2 |
| InChI | InChI=1S/C15H21N3O/c1-15(2)11-4-3-10(12(15)7-11)5-6-17-14(19)13-8-16-9-18-13/h3,8-9,11-12H,4-7H2,1-2H3,(H,16,18)(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | QDOLFDMMWCMSGG-RYUDHWBXSA-N |
| XLogP | 2.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|