C22H33NO — CID 150781593
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]adamantane-1-carboxamide (PubChem CID 150781593) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 150781593 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]adamantane-1-carboxamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNC(=O)C34CC5CC(CC(C5)C3)C4)[C@@H]1C2 |
| InChI | InChI=1S/C22H33NO/c1-21(2)18-4-3-17(19(21)10-18)5-6-23-20(24)22-11-14-7-15(12-22)9-16(8-14)13-22/h3,14-16,18-19H,4-13H2,1-2H3,(H,23,24)/t14?,15?,16?,18-,19-,22?/m0/s1 |
| InChIKey | KBZMMMBGVMFVFL-XJPUKHNYSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|