C15H21N3OS — CID 118772746
3-amino-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1,2-thiazole-4-carboxamide (PubChem CID 118772746) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-amino-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118772746 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-amino-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-1,2-thiazole-4-carboxamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNC(=O)c3csnc3N)[C@@H]1C2 |
| InChI | InChI=1S/C15H21N3OS/c1-15(2)10-4-3-9(12(15)7-10)5-6-17-14(19)11-8-20-18-13(11)16/h3,8,10,12H,4-7H2,1-2H3,(H2,16,18)(H,17,19)/t10-,12-/m0/s1 |
| InChIKey | FYZNTJKCOQXZIF-JQWIXIFHSA-N |
| XLogP | 2.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|