C17H26N6O — CID 166307982
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-(2H-tetrazol-5-yl)pyrrolidine-1-carboxamide (PubChem CID 166307982) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-(2H-tetrazol-5-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-(2H-tetrazol-5-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 166307982 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-(2H-tetrazol-5-yl)pyrrolidine-1-carboxamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNC(=O)N3CCC(c4nn[nH]n4)C3)[C@@H]1C2 |
| InChI | InChI=1S/C17H26N6O/c1-17(2)13-4-3-11(14(17)9-13)5-7-18-16(24)23-8-6-12(10-23)15-19-21-22-20-15/h3,12-14H,4-10H2,1-2H3,(H,18,24)(H,19,20,21,22)/t12?,13-,14-/m0/s1 |
| InChIKey | OFULGEQRCYFAFW-TTZKSVMKSA-N |
| XLogP | 2.08 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|