C18H25N3O — CID 118789106
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-pyrazin-2-ylpropanamide (PubChem CID 118789106) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-pyrazin-2-ylpropanamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-pyrazin-2-ylpropanamide |
|---|---|
| PubChem CID | 118789106 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-3-pyrazin-2-ylpropanamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNC(=O)CCc3cnccn3)[C@@H]1C2 |
| InChI | InChI=1S/C18H25N3O/c1-18(2)14-4-3-13(16(18)11-14)7-8-21-17(22)6-5-15-12-19-9-10-20-15/h3,9-10,12,14,16H,4-8,11H2,1-2H3,(H,21,22)/t14-,16-/m0/s1 |
| InChIKey | VONKZOUQNFSYDY-HOCLYGCPSA-N |
| XLogP | 2.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|