C15H26N2O2S — CID 131916183
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]pyrrolidine-1-sulfonamide (PubChem CID 131916183) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 131916183 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]pyrrolidine-1-sulfonamide |
| SMILES | CC1(C)[C@H]2CC=C(CCNS(=O)(=O)N3CCCC3)[C@@H]1C2 |
| InChI | InChI=1S/C15H26N2O2S/c1-15(2)13-6-5-12(14(15)11-13)7-8-16-20(18,19)17-9-3-4-10-17/h5,13-14,16H,3-4,6-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | VYSIBUDCHBPPFX-KBPBESRZSA-N |
| XLogP | 2.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|