C15H24N6O3 — CID 166299406
tert-butyl N-[1-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]cyclobutyl]carbamate (PubChem CID 166299406) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 166299406 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl N-[1-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)N2CCC(c3nn[nH]n3)C2)CCC1 |
| InChI | InChI=1S/C15H24N6O3/c1-14(2,3)24-13(23)16-15(6-4-7-15)12(22)21-8-5-10(9-21)11-17-19-20-18-11/h10H,4-9H2,1-3H3,(H,16,23)(H,17,18,19,20) |
| InChIKey | HTGLUYIUCXASJW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |