C16H28N6O3 — CID 75387001
tert-butyl N-[2-methyl-4-oxo-4-[3-(2H-tetrazol-5-yl)piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 75387001) has the molecular formula C16H28N6O3 and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-4-oxo-4-[3-(2H-tetrazol-5-yl)piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-4-oxo-4-[3-(2H-tetrazol-5-yl)piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 75387001 |
| Molecular Formula | C16H28N6O3 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-[2-methyl-4-oxo-4-[3-(2H-tetrazol-5-yl)piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(CC(=O)N1CCCC(c2nn[nH]n2)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N6O3/c1-15(2,3)25-14(24)17-16(4,5)9-12(23)22-8-6-7-11(10-22)13-18-20-21-19-13/h11H,6-10H2,1-5H3,(H,17,24)(H,18,19,20,21) |
| InChIKey | WUCOHZDIHCBIMU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |