C13H24N6O2 — CID 80547209
tert-butyl 3-[(2H-tetrazol-5-ylmethylamino)methyl]piperidine-1-carboxylate (PubChem CID 80547209) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is tert-butyl 3-[(2H-tetrazol-5-ylmethylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2H-tetrazol-5-ylmethylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 80547209 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | tert-butyl 3-[(2H-tetrazol-5-ylmethylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNCc2nn[nH]n2)C1 |
| InChI | InChI=1S/C13H24N6O2/c1-13(2,3)21-12(20)19-6-4-5-10(9-19)7-14-8-11-15-17-18-16-11/h10,14H,4-9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | NSOSAXRNSDAVBH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |