C24H33FN4O4S — CID 143317614
tert-butyl N-[1-(3-methyl-1,4-diazepane-1-carbonyl)cyclopropyl]carbamate;4-fluoro-5-hydroxysulfanylisoquinoline (PubChem CID 143317614) has the molecular formula C24H33FN4O4S and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[1-(3-methyl-1,4-diazepane-1-carbonyl)cyclopropyl]carbamate;4-fluoro-5-hydroxysulfanylisoquinoline.
| Compound Name | tert-butyl N-[1-(3-methyl-1,4-diazepane-1-carbonyl)cyclopropyl]carbamate;4-fluoro-5-hydroxysulfanylisoquinoline |
|---|---|
| PubChem CID | 143317614 |
| Molecular Formula | C24H33FN4O4S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | tert-butyl N-[1-(3-methyl-1,4-diazepane-1-carbonyl)cyclopropyl]carbamate;4-fluoro-5-hydroxysulfanylisoquinoline |
| SMILES | CC1CN(C(=O)C2(NC(=O)OC(C)(C)C)CC2)CCCN1.OSc1cccc2cncc(F)c12 |
| InChI | InChI=1S/C15H27N3O3.C9H6FNOS/c1-11-10-18(9-5-8-16-11)12(19)15(6-7-15)17-13(20)21-14(2,3)4;10-7-5-11-4-6-2-1-3-8(13-12)9(6)7/h11,16H,5-10H2,1-4H3,(H,17,20);1-5,12H |
| InChIKey | NNSZNLXCCQWYGP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|