C38H41N3O6 — CID 124864100
2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(3,3-diphenylpropyl)acetamide (PubChem CID 124864100) has the molecular formula C38H41N3O6 and a molecular weight of 635.76 g/mol. Its IUPAC name is 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(3,3-diphenylpropyl)acetamide.
| Compound Name | 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(3,3-diphenylpropyl)acetamide |
|---|---|
| PubChem CID | 124864100 |
| Molecular Formula | C38H41N3O6 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(3,3-diphenylpropyl)acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCC(=O)NCCC(c3ccccc3)c3ccccc3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C38H41N3O6/c1-24(42)41-31-17-15-27-21-34(45-2)37(46-3)38(47-4)36(27)29-16-18-32(33(43)22-30(29)31)40-23-35(44)39-20-19-28(25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-14,16,18,21-22,28,31H,15,17,19-20,23H2,1-4H3,(H,39,44)(H,40,43)(H,41,42)/t31-/m1/s1 |
| InChIKey | WNZCAYFOKXPRQU-WJOKGBTCSA-N |
| XLogP | 5.61 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |