C31H35N3O6S — CID 75492106
2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 75492106) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is 2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 75492106 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCC(=O)NCCSc3ccccc3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C31H35N3O6S/c1-19(35)34-24-12-10-20-16-27(38-2)30(39-3)31(40-4)29(20)22-11-13-25(26(36)17-23(22)24)33-18-28(37)32-14-15-41-21-8-6-5-7-9-21/h5-9,11,13,16-17,24H,10,12,14-15,18H2,1-4H3,(H,32,37)(H,33,36)(H,34,35)/t24-/m0/s1 |
| InChIKey | RPORCOIZZBEDTI-DEOSSOPVSA-N |
| XLogP | 4.18 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|