C15H22O4 — CID 124866966
(1R,2S,5R,6R,9R,11R)-11-(hydroxymethyl)-2,11-dimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid (PubChem CID 124866966) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,2S,5R,6R,9R,11R)-11-(hydroxymethyl)-2,11-dimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid.
| Compound Name | (1R,2S,5R,6R,9R,11R)-11-(hydroxymethyl)-2,11-dimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 124866966 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,2S,5R,6R,9R,11R)-11-(hydroxymethyl)-2,11-dimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
| SMILES | C[C@@H]1C(=O)C[C@@H]2[C@H]3CC[C@@H](C(=O)O)[C@@]12C[C@@]3(C)CO |
| InChI | InChI=1S/C15H22O4/c1-8-12(17)5-11-9-3-4-10(13(18)19)15(8,11)6-14(9,2)7-16/h8-11,16H,3-7H2,1-2H3,(H,18,19)/t8-,9-,10+,11-,14+,15-/m1/s1 |
| InChIKey | QIYQVTNAEPQSBX-ABYUPDDJSA-N |
| XLogP | 1.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |