C15H22O3 — CID 38358866
(1R,2R,5S,6R,9R)-2,11,11-trimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid (PubChem CID 38358866) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2R,5S,6R,9R)-2,11,11-trimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid.
| Compound Name | (1R,2R,5S,6R,9R)-2,11,11-trimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 38358866 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2R,5S,6R,9R)-2,11,11-trimethyl-3-oxotricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
| SMILES | C[C@H]1C(=O)C[C@H]2[C@H]3CC[C@@H](C(=O)O)[C@@]12CC3(C)C |
| InChI | InChI=1S/C15H22O3/c1-8-12(16)6-11-9-4-5-10(13(17)18)15(8,11)7-14(9,2)3/h8-11H,4-7H2,1-3H3,(H,17,18)/t8-,9+,10-,11-,15+/m0/s1 |
| InChIKey | UFLSHMKXGZOAQP-XVRCYRPSSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |