C17H30O — CID 124867350
(1R,2R,6R)-2-methyl-6-[(1R,2R,4R,6R)-5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol (PubChem CID 124867350) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (1R,2R,6R)-2-methyl-6-[(1R,2R,4R,6R)-5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-methyl-6-[(1R,2R,4R,6R)-5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 124867350 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (1R,2R,6R)-2-methyl-6-[(1R,2R,4R,6R)-5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol |
| SMILES | C[C@@H]1CCC[C@H]([C@@H]2C[C@H]3C[C@H]2[C@@H](C)C3(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H30O/c1-10-6-5-7-13(16(10)18)15-9-12-8-14(15)11(2)17(12,3)4/h10-16,18H,5-9H2,1-4H3/t10-,11-,12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | DKDJZSWJGXMOQI-OTFNZQRDSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |