C21H24N2O2 — CID 124869444
3-phenyl-1-[5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]propan-1-one (PubChem CID 124869444) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-phenyl-1-[5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]propan-1-one.
| Compound Name | 3-phenyl-1-[5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 124869444 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-phenyl-1-[5-(prop-2-enoxymethyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]propan-1-one |
| SMILES | C=CCOCc1cncc2c1CCN(C(=O)CCc1ccccc1)C2 |
| InChI | InChI=1S/C21H24N2O2/c1-2-12-25-16-19-14-22-13-18-15-23(11-10-20(18)19)21(24)9-8-17-6-4-3-5-7-17/h2-7,13-14H,1,8-12,15-16H2 |
| InChIKey | PVYDUOJXDMJBEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|