C15H16Cl2N4O — CID 124874994
4-amino-3,5-dichloro-N-[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]benzamide (PubChem CID 124874994) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]benzamide |
|---|---|
| PubChem CID | 124874994 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]benzamide |
| SMILES | Cn1cc2c(n1)CCC[C@@H]2NC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4O/c1-21-7-9-12(3-2-4-13(9)20-21)19-15(22)8-5-10(16)14(18)11(17)6-8/h5-7,12H,2-4,18H2,1H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | ICEMRSWBYZPXNQ-LBPRGKRZSA-N |
| XLogP | 3.12 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|