C16H22Cl2N2O — CID 82813808
4-amino-3,5-dichloro-N-(2-propan-2-ylcyclohexyl)benzamide (PubChem CID 82813808) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-propan-2-ylcyclohexyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(2-propan-2-ylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 82813808 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-propan-2-ylcyclohexyl)benzamide |
| SMILES | CC(C)C1CCCCC1NC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-9(2)11-5-3-4-6-14(11)20-16(21)10-7-12(17)15(19)13(18)8-10/h7-9,11,14H,3-6,19H2,1-2H3,(H,20,21) |
| InChIKey | WPWCCGPUUSWRGP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|