C15H19N5O3S — CID 136540795
1-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(4-sulfamoylphenyl)urea (PubChem CID 136540795) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 136540795 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(4-sulfamoylphenyl)urea |
| SMILES | Cn1cc2c(n1)CCCC2NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H19N5O3S/c1-20-9-12-13(3-2-4-14(12)19-20)18-15(21)17-10-5-7-11(8-6-10)24(16,22)23/h5-9,13H,2-4H2,1H3,(H2,16,22,23)(H2,17,18,21) |
| InChIKey | LNBACTJNKZLUCE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |