C14H14N2O3S — CID 124876163
5-[(1S)-1-hydroxyethyl]-N-methyl-N-prop-2-ynyl-3-thiophen-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 124876163) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-[(1S)-1-hydroxyethyl]-N-methyl-N-prop-2-ynyl-3-thiophen-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-[(1S)-1-hydroxyethyl]-N-methyl-N-prop-2-ynyl-3-thiophen-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 124876163 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-[(1S)-1-hydroxyethyl]-N-methyl-N-prop-2-ynyl-3-thiophen-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | C#CCN(C)C(=O)c1c(-c2cccs2)noc1[C@H](C)O |
| InChI | InChI=1S/C14H14N2O3S/c1-4-7-16(3)14(18)11-12(10-6-5-8-20-10)15-19-13(11)9(2)17/h1,5-6,8-9,17H,7H2,2-3H3/t9-/m0/s1 |
| InChIKey | LUTVSTMOHBUHTQ-VIFPVBQESA-N |
| XLogP | 2.16 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|