C14H14N2O2S2 — CID 71930483
N-prop-2-ynyl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]propanamide (PubChem CID 71930483) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-prop-2-ynyl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]propanamide.
| Compound Name | N-prop-2-ynyl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 71930483 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-prop-2-ynyl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]propanamide |
| SMILES | C#CCNC(=O)C(C)SCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-3-6-15-14(17)10(2)20-9-11-8-12(18-16-11)13-5-4-7-19-13/h1,4-5,7-8,10H,6,9H2,2H3,(H,15,17) |
| InChIKey | GSSULPSTQFHSPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|