C18H24N4O2 — CID 124877407
(5R)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide (PubChem CID 124877407) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (5R)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide.
| Compound Name | (5R)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 124877407 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (5R)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]-4,5,6,7-tetrahydro-2H-benzotriazole-5-carboxamide |
| SMILES | Cc1cc2c(o1)CC(C)(C)C[C@H]2NC(=O)[C@@H]1CCc2n[nH]nc2C1 |
| InChI | InChI=1S/C18H24N4O2/c1-10-6-12-15(8-18(2,3)9-16(12)24-10)19-17(23)11-4-5-13-14(7-11)21-22-20-13/h6,11,15H,4-5,7-9H2,1-3H3,(H,19,23)(H,20,21,22)/t11-,15-/m1/s1 |
| InChIKey | KHKBJVJSKKGCTQ-IAQYHMDHSA-N |
| XLogP | 2.64 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |