C19H27NO2 — CID 98751125
(1S,2S,4S)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98751125) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (1S,2S,4S)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98751125 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (1S,2S,4S)-N-[(4R)-2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1cc2c(o1)CC(C)(C)C[C@H]2NC(=O)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H27NO2/c1-11-6-15-16(9-19(2,3)10-17(15)22-11)20-18(21)14-8-12-4-5-13(14)7-12/h6,12-14,16H,4-5,7-10H2,1-3H3,(H,20,21)/t12-,13-,14-,16+/m0/s1 |
| InChIKey | OZLZGUXDBDHJOA-RZLSGREXSA-N |
| XLogP | 4.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |