C19H26N2O4 — CID 124882838
[4-[2-[(3S,4R)-3-methyl-4-morpholin-4-ylpyrrolidin-1-yl]-2-oxoethyl]phenyl] acetate (PubChem CID 124882838) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [4-[2-[(3S,4R)-3-methyl-4-morpholin-4-ylpyrrolidin-1-yl]-2-oxoethyl]phenyl] acetate.
| Compound Name | [4-[2-[(3S,4R)-3-methyl-4-morpholin-4-ylpyrrolidin-1-yl]-2-oxoethyl]phenyl] acetate |
|---|---|
| PubChem CID | 124882838 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [4-[2-[(3S,4R)-3-methyl-4-morpholin-4-ylpyrrolidin-1-yl]-2-oxoethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC(=O)N2C[C@H](C)[C@@H](N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-14-12-21(13-18(14)20-7-9-24-10-8-20)19(23)11-16-3-5-17(6-4-16)25-15(2)22/h3-6,14,18H,7-13H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | HDPNIECVAIPPNH-KSSFIOAISA-N |
| XLogP | 1.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|