C18H23N5O2 — CID 124885834
(9aS)-N-(5-methyl-1-phenylpyrazol-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide (PubChem CID 124885834) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (9aS)-N-(5-methyl-1-phenylpyrazol-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide.
| Compound Name | (9aS)-N-(5-methyl-1-phenylpyrazol-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide |
|---|---|
| PubChem CID | 124885834 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (9aS)-N-(5-methyl-1-phenylpyrazol-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide |
| SMILES | Cc1c(NC(=O)N2CCN3CCOC[C@@H]3C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C18H23N5O2/c1-14-17(11-19-23(14)15-5-3-2-4-6-15)20-18(24)22-8-7-21-9-10-25-13-16(21)12-22/h2-6,11,16H,7-10,12-13H2,1H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | BGFOUNUBEMTCGE-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |