C15H25NO3 — CID 124885895
ethyl (2S)-2-[[(1R)-cyclohex-2-en-1-yl]amino]-2-(oxan-4-yl)acetate (PubChem CID 124885895) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1R)-cyclohex-2-en-1-yl]amino]-2-(oxan-4-yl)acetate.
| Compound Name | ethyl (2S)-2-[[(1R)-cyclohex-2-en-1-yl]amino]-2-(oxan-4-yl)acetate |
|---|---|
| PubChem CID | 124885895 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | ethyl (2S)-2-[[(1R)-cyclohex-2-en-1-yl]amino]-2-(oxan-4-yl)acetate |
| SMILES | CCOC(=O)[C@@H](N[C@H]1C=CCCC1)C1CCOCC1 |
| InChI | InChI=1S/C15H25NO3/c1-2-19-15(17)14(12-8-10-18-11-9-12)16-13-6-4-3-5-7-13/h4,6,12-14,16H,2-3,5,7-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | CALVXWDPTKVQNK-KBPBESRZSA-N |
| XLogP | 2.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|