About lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate
lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate (PubChem CID 160833087) has the molecular formula C15H29BrLiNO3
and a molecular weight of 358.25 g/mol. Its IUPAC name is lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate.
Molecular Properties
| Compound Name | lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate |
| PubChem CID | 160833087 |
| Molecular Formula | C15H29BrLiNO3 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate |
| SMILES | CC(C)[N-]C(C)C.CCOC(=O)C(Br)C1CCOCC1.[Li+] |
| InChI | InChI=1S/C9H15BrO3.C6H14N.Li/c1-2-13-9(11)8(10)7-3-5-12-6-4-7;1-5(2)7-6(3)4;/h7-8H,2-6H2,1H3;5-6H,1-4H3;/q;-1;+1 |
| InChIKey | QPNPOMHSIJDXHX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate?
The IUPAC name of lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate (CID 160833087) is lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate.
What is the SMILES notation for lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate?
The canonical SMILES for lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate is CC(C)[N-]C(C)C.CCOC(=O)C(Br)C1CCOCC1.[Li+].
What is the InChIKey of lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate?
The InChIKey is QPNPOMHSIJDXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO3.C6H14N.Li/c1-2-13-9(11)8(10)7-3-5-12-6-4-7;1-5(2)7-6(3)4;/h7-8H,2-6H2,1H3;5-6H,1-4H3;/q;-1;+1.
What are the key properties of lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate?
lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate has a molecular weight of 358.25 g/mol, XLogP of 0.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;di(propan-2-yl)azanide;ethyl 2-bromo-2-(oxan-4-yl)acetate is sourced from PubChem (CID 160833087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).