C8H12Br2O2 — CID 171562539
ethyl 2,3-dibromo-3-cyclopropylpropanoate (PubChem CID 171562539) has the molecular formula C8H12Br2O2 and a molecular weight of 299.99 g/mol. Its IUPAC name is ethyl 2,3-dibromo-3-cyclopropylpropanoate.
| Compound Name | ethyl 2,3-dibromo-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 171562539 |
| Molecular Formula | C8H12Br2O2 |
| Molecular Weight | 299.99 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | ethyl 2,3-dibromo-3-cyclopropylpropanoate |
| SMILES | CCOC(=O)C(Br)C(Br)C1CC1 |
| InChI | InChI=1S/C8H12Br2O2/c1-2-12-8(11)7(10)6(9)5-3-4-5/h5-7H,2-4H2,1H3 |
| InChIKey | MTWISRJBMIMWCV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.99 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|