C18H31N5O2 — CID 124886897
N'-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methoxy]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethanimidamide (PubChem CID 124886897) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N'-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methoxy]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethanimidamide.
| Compound Name | N'-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methoxy]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 124886897 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | N'-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methoxy]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethanimidamide |
| SMILES | C[C@@H]1CCC[C@@H](C)N1C/C(N)=N\OCc1noc(C2CCCCC2)n1 |
| InChI | InChI=1S/C18H31N5O2/c1-13-7-6-8-14(2)23(13)11-16(19)21-24-12-17-20-18(25-22-17)15-9-4-3-5-10-15/h13-15H,3-12H2,1-2H3,(H2,19,21)/t13-,14-/m1/s1 |
| InChIKey | JDGZXYJNUOIAQT-ZIAGYGMSSA-N |
| XLogP | 3.17 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|