C7H11N3O — CID 124887297
(1S,2R,3R)-3-amino-2-pyrazol-1-ylcyclobutan-1-ol (PubChem CID 124887297) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is (1S,2R,3R)-3-amino-2-pyrazol-1-ylcyclobutan-1-ol.
| Compound Name | (1S,2R,3R)-3-amino-2-pyrazol-1-ylcyclobutan-1-ol |
|---|---|
| PubChem CID | 124887297 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | (1S,2R,3R)-3-amino-2-pyrazol-1-ylcyclobutan-1-ol |
| SMILES | N[C@@H]1C[C@H](O)[C@@H]1n1cccn1 |
| InChI | InChI=1S/C7H11N3O/c8-5-4-6(11)7(5)10-3-1-2-9-10/h1-3,5-7,11H,4,8H2/t5-,6+,7-/m1/s1 |
| InChIKey | ROPAYOUEKKPZNL-DSYKOEDSSA-N |
| XLogP | -0.48 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |