C9H15N3O — CID 124710362
(1R,2R,3R)-3-ethoxy-2-pyrazol-1-ylcyclobutan-1-amine (PubChem CID 124710362) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (1R,2R,3R)-3-ethoxy-2-pyrazol-1-ylcyclobutan-1-amine.
| Compound Name | (1R,2R,3R)-3-ethoxy-2-pyrazol-1-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 124710362 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1R,2R,3R)-3-ethoxy-2-pyrazol-1-ylcyclobutan-1-amine |
| SMILES | CCO[C@@H]1C[C@@H](N)[C@H]1n1cccn1 |
| InChI | InChI=1S/C9H15N3O/c1-2-13-8-6-7(10)9(8)12-5-3-4-11-12/h3-5,7-9H,2,6,10H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | VFKMPRBJWCWEAU-IWSPIJDZSA-N |
| XLogP | 0.56 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |