C19H17N3O4S2 — CID 124891780
N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide (PubChem CID 124891780) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 124891780 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]-4-pyrazol-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC[C@](O)(c1ccsc1)c1ccco1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C19H17N3O4S2/c23-19(15-8-12-27-13-15,18-3-1-11-26-18)14-21-28(24,25)17-6-4-16(5-7-17)22-10-2-9-20-22/h1-13,21,23H,14H2/t19-/m0/s1 |
| InChIKey | GOODSXIEIJVTBV-IBGZPJMESA-N |
| XLogP | 2.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |