C20H18N2O7S — CID 129354958
4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-2-(furan-2-yl)-2-(furan-3-yl)-2-hydroxyethyl]benzenesulfonamide (PubChem CID 129354958) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-2-(furan-2-yl)-2-(furan-3-yl)-2-hydroxyethyl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-2-(furan-2-yl)-2-(furan-3-yl)-2-hydroxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129354958 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-2-(furan-2-yl)-2-(furan-3-yl)-2-hydroxyethyl]benzenesulfonamide |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)NC[C@](O)(c2ccoc2)c2ccco2)cc1 |
| InChI | InChI=1S/C20H18N2O7S/c23-18-7-8-19(24)22(18)15-3-5-16(6-4-15)30(26,27)21-13-20(25,14-9-11-28-12-14)17-2-1-10-29-17/h1-6,9-12,21,25H,7-8,13H2/t20-/m0/s1 |
| InChIKey | QBGVLVUGWFNMHJ-FQEVSTJZSA-N |
| XLogP | 1.74 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|