C22H19NO4 — CID 1248929
3-[11-(2-carboxyethyl)indeno[1,2-b]quinolin-11-yl]propanoic acid (PubChem CID 1248929) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[11-(2-carboxyethyl)indeno[1,2-b]quinolin-11-yl]propanoic acid.
| Compound Name | 3-[11-(2-carboxyethyl)indeno[1,2-b]quinolin-11-yl]propanoic acid |
|---|---|
| PubChem CID | 1248929 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[11-(2-carboxyethyl)indeno[1,2-b]quinolin-11-yl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)O)c2ccccc2-c2nc3ccccc3cc21 |
| InChI | InChI=1S/C22H19NO4/c24-19(25)9-11-22(12-10-20(26)27)16-7-3-2-6-15(16)21-17(22)13-14-5-1-4-8-18(14)23-21/h1-8,13H,9-12H2,(H,24,25)(H,26,27) |
| InChIKey | RNGWITXLYBYESP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |