C24H23NO2 — CID 163648213
4-[11-(3-oxobutyl)indeno[1,2-b]quinolin-11-yl]butan-2-one (PubChem CID 163648213) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-[11-(3-oxobutyl)indeno[1,2-b]quinolin-11-yl]butan-2-one.
| Compound Name | 4-[11-(3-oxobutyl)indeno[1,2-b]quinolin-11-yl]butan-2-one |
|---|---|
| PubChem CID | 163648213 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[11-(3-oxobutyl)indeno[1,2-b]quinolin-11-yl]butan-2-one |
| SMILES | CC(=O)CCC1(CCC(C)=O)c2ccccc2-c2nc3ccccc3cc21 |
| InChI | InChI=1S/C24H23NO2/c1-16(26)11-13-24(14-12-17(2)27)20-9-5-4-8-19(20)23-21(24)15-18-7-3-6-10-22(18)25-23/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | HMHMTDWVXDRXCC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |