C27H26N2O4 — CID 168800313
2-[11-[2-(2-methylprop-2-enoyloxy)ethyl]indeno[1,2-b]quinoxalin-11-yl]ethyl 2-methylprop-2-enoate (PubChem CID 168800313) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[11-[2-(2-methylprop-2-enoyloxy)ethyl]indeno[1,2-b]quinoxalin-11-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[11-[2-(2-methylprop-2-enoyloxy)ethyl]indeno[1,2-b]quinoxalin-11-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168800313 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[11-[2-(2-methylprop-2-enoyloxy)ethyl]indeno[1,2-b]quinoxalin-11-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC1(CCOC(=O)C(=C)C)c2ccccc2-c2nc3ccccc3nc21 |
| InChI | InChI=1S/C27H26N2O4/c1-17(2)25(30)32-15-13-27(14-16-33-26(31)18(3)4)20-10-6-5-9-19(20)23-24(27)29-22-12-8-7-11-21(22)28-23/h5-12H,1,3,13-16H2,2,4H3 |
| InChIKey | MGVCCFAILJTMHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|