C45H38O4 — CID 169209808
2-[9-[2-(2-methylprop-2-enoyloxy)ethyl]-3,6-dinaphthalen-2-ylfluoren-9-yl]ethyl 2-methylprop-2-enoate (PubChem CID 169209808) has the molecular formula C45H38O4 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2-[9-[2-(2-methylprop-2-enoyloxy)ethyl]-3,6-dinaphthalen-2-ylfluoren-9-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[9-[2-(2-methylprop-2-enoyloxy)ethyl]-3,6-dinaphthalen-2-ylfluoren-9-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169209808 |
| Molecular Formula | C45H38O4 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[9-[2-(2-methylprop-2-enoyloxy)ethyl]-3,6-dinaphthalen-2-ylfluoren-9-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC1(CCOC(=O)C(=C)C)c2ccc(-c3ccc4ccccc4c3)cc2-c2cc(-c3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C45H38O4/c1-29(2)43(46)48-23-21-45(22-24-49-44(47)30(3)4)41-19-17-37(35-15-13-31-9-5-7-11-33(31)25-35)27-39(41)40-28-38(18-20-42(40)45)36-16-14-32-10-6-8-12-34(32)26-36/h5-20,25-28H,1,3,21-24H2,2,4H3 |
| InChIKey | JIFQBDJSKQDKQF-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|