C34H34Cl2N2O8 — CID 167210497
2-[2-[[7,8-dichloro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]methyl]-3-oxopropoxy]ethyl 2-methylprop-2-enoate (PubChem CID 167210497) has the molecular formula C34H34Cl2N2O8 and a molecular weight of 669.56 g/mol. Its IUPAC name is 2-[2-[[7,8-dichloro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]methyl]-3-oxopropoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[[7,8-dichloro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]methyl]-3-oxopropoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167210497 |
| Molecular Formula | C34H34Cl2N2O8 |
| Molecular Weight | 669.56 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | 2-[2-[[7,8-dichloro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]methyl]-3-oxopropoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(C=O)CC1(CCC(=O)OCCOC(=O)C(=C)C)c2ccccc2-c2nc3cc(Cl)c(Cl)cc3nc21 |
| InChI | InChI=1S/C34H34Cl2N2O8/c1-20(2)32(41)45-12-11-43-19-22(18-39)17-34(10-9-29(40)44-13-14-46-33(42)21(3)4)24-8-6-5-7-23(24)30-31(34)38-28-16-26(36)25(35)15-27(28)37-30/h5-8,15-16,18,22H,1,3,9-14,17,19H2,2,4H3 |
| InChIKey | UGPSHEVQOQNCKH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|